ChemNet > CAS > 4923-87-9;133150-64-8 5-Bromobenzo[b]thiophene
4923-87-9;133150-64-8 5-Bromobenzo[b]thiophene
| 상품명칭 |
5-Bromobenzo[b]thiophene |
| 별명 |
5-Bromothianaphthene; 5-bromo-1-benzothiophene; 5-Bromobenzo[b]thioophene; 5-Bromobenzothiophene; ; BUTTPARK 98\04-80; Benzo[c]thiophene, 5-bromo- |
| 분자식 |
C8H5BrS |
| 분자량 |
213.0943 |
| InChI |
InChI=1/C8H5BrS/c9-7-1-2-8-6(5-7)3-4-10-8/h1-5H |
| cas번호 |
4923-87-9;133150-64-8 |
| 분자 구조 |
![4923-87-9;133150-64-8 5-Bromobenzo[b]thiophene](https://images-a.chemnet.com/suppliers/chembase/793/79390.gif)
|
| 밀도 |
1.649g/cm3 |
| 녹는 점 |
46℃ |
| 비등점 |
284.7°C at 760 mmHg |
| 굴절 지수 |
1.704 |
| 인화점 |
126°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
